C8H10BrN4RbS — CID 172620935
8-amino-1-bromoimidazo[1,5-a]pyrazine-3-thiolate;ethane;rubidium(1+) (PubChem CID 172620935) has the molecular formula C8H10BrN4RbS and a molecular weight of 359.64 g/mol. Its IUPAC name is 8-amino-1-bromoimidazo[1,5-a]pyrazine-3-thiolate;ethane;rubidium(1+).
| Compound Name | 8-amino-1-bromoimidazo[1,5-a]pyrazine-3-thiolate;ethane;rubidium(1+) |
|---|---|
| PubChem CID | 172620935 |
| Molecular Formula | C8H10BrN4RbS |
| Molecular Weight | 359.64 g/mol |
| Exact Mass | 357.89 |
| IUPAC Name | 8-amino-1-bromoimidazo[1,5-a]pyrazine-3-thiolate;ethane;rubidium(1+) |
| SMILES | CC.Nc1nccn2c([S-])nc(Br)c12.[Rb+] |
| InChI | InChI=1S/C6H5BrN4S.C2H6.Rb/c7-4-3-5(8)9-1-2-11(3)6(12)10-4;1-2;/h1-2H,(H2,8,9)(H,10,12);1-2H3;/q;;+1/p-1 |
| InChIKey | IFLOBWFYYJXJNP-UHFFFAOYSA-M |
| XLogP | -0.99 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.64 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|