About 1-bromo-3-(2,2-dimethyloxan-4-yl)imidazo[1,5-a]pyrazin-8-amine
1-bromo-3-(2,2-dimethyloxan-4-yl)imidazo[1,5-a]pyrazin-8-amine (PubChem CID 157102374) has the molecular formula C26H34Br2N8O2
and a molecular weight of 650.42 g/mol. Its IUPAC name is 1-bromo-3-(2,2-dimethyloxan-4-yl)imidazo[1,5-a]pyrazin-8-amine.
Molecular Properties
| Compound Name | 1-bromo-3-(2,2-dimethyloxan-4-yl)imidazo[1,5-a]pyrazin-8-amine |
| PubChem CID | 157102374 |
| Molecular Formula | C26H34Br2N8O2 |
| Molecular Weight | 650.42 g/mol |
| Exact Mass | 648.12 |
| IUPAC Name | 1-bromo-3-(2,2-dimethyloxan-4-yl)imidazo[1,5-a]pyrazin-8-amine |
| SMILES | CC1(C)CC(c2nc(Br)c3c(N)nccn23)CCO1.CC1(C)CC(c2nc(Br)c3c(N)nccn23)CCO1 |
| InChI | InChI=1S/2C13H17BrN4O/c2*1-13(2)7-8(3-6-19-13)12-17-10(14)9-11(15)16-4-5-18(9)12/h2*4-5,8H,3,6-7H2,1-2H3,(H2,15,16) |
| InChIKey | AFXHILYZEPIDKN-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 130.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 650.42 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
Analyze 1-bromo-3-(2,2-dimethyloxan-4-yl)imidazo[1,5-a]pyrazin-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-3-(2,2-dimethyloxan-4-yl)imidazo[1,5-a]pyrazin-8-amine?
The IUPAC name of 1-bromo-3-(2,2-dimethyloxan-4-yl)imidazo[1,5-a]pyrazin-8-amine (CID 157102374) is 1-bromo-3-(2,2-dimethyloxan-4-yl)imidazo[1,5-a]pyrazin-8-amine.
What is the SMILES notation for 1-bromo-3-(2,2-dimethyloxan-4-yl)imidazo[1,5-a]pyrazin-8-amine?
The canonical SMILES for 1-bromo-3-(2,2-dimethyloxan-4-yl)imidazo[1,5-a]pyrazin-8-amine is CC1(C)CC(c2nc(Br)c3c(N)nccn23)CCO1.CC1(C)CC(c2nc(Br)c3c(N)nccn23)CCO1.
What is the InChIKey of 1-bromo-3-(2,2-dimethyloxan-4-yl)imidazo[1,5-a]pyrazin-8-amine?
The InChIKey is AFXHILYZEPIDKN-UHFFFAOYSA-N. The full InChI is InChI=1S/2C13H17BrN4O/c2*1-13(2)7-8(3-6-19-13)12-17-10(14)9-11(15)16-4-5-18(9)12/h2*4-5,8H,3,6-7H2,1-2H3,(H2,15,16).
What are the key properties of 1-bromo-3-(2,2-dimethyloxan-4-yl)imidazo[1,5-a]pyrazin-8-amine?
1-bromo-3-(2,2-dimethyloxan-4-yl)imidazo[1,5-a]pyrazin-8-amine has a molecular weight of 650.42 g/mol, XLogP of 5.49, 2 rotatable bonds, 2 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-3-(2,2-dimethyloxan-4-yl)imidazo[1,5-a]pyrazin-8-amine is sourced from PubChem (CID 157102374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).