C14H18BrN5O — CID 123183862
3-(1,3,4,6,7,8,9,9a-octahydropyrido[2,1-c][1,4]oxazin-7-yl)-1-bromoimidazo[1,5-a]pyrazin-8-amine (PubChem CID 123183862) has the molecular formula C14H18BrN5O and a molecular weight of 352.24 g/mol. Its IUPAC name is 3-(1,3,4,6,7,8,9,9a-octahydropyrido[2,1-c][1,4]oxazin-7-yl)-1-bromoimidazo[1,5-a]pyrazin-8-amine.
| Compound Name | 3-(1,3,4,6,7,8,9,9a-octahydropyrido[2,1-c][1,4]oxazin-7-yl)-1-bromoimidazo[1,5-a]pyrazin-8-amine |
|---|---|
| PubChem CID | 123183862 |
| Molecular Formula | C14H18BrN5O |
| Molecular Weight | 352.24 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | 3-(1,3,4,6,7,8,9,9a-octahydropyrido[2,1-c][1,4]oxazin-7-yl)-1-bromoimidazo[1,5-a]pyrazin-8-amine |
| SMILES | Nc1nccn2c(C3CCC4COCCN4C3)nc(Br)c12 |
| InChI | InChI=1S/C14H18BrN5O/c15-12-11-13(16)17-3-4-20(11)14(18-12)9-1-2-10-8-21-6-5-19(10)7-9/h3-4,9-10H,1-2,5-8H2,(H2,16,17) |
| InChIKey | XVKFOPAYSGBOBW-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 68.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.24 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |