C10H16N4 — CID 145365333
ethane;2-ethylimidazo[1,2-a]pyrazin-8-amine (PubChem CID 145365333) has the molecular formula C10H16N4 and a molecular weight of 192.27 g/mol. Its IUPAC name is ethane;2-ethylimidazo[1,2-a]pyrazin-8-amine.
| Compound Name | ethane;2-ethylimidazo[1,2-a]pyrazin-8-amine |
|---|---|
| PubChem CID | 145365333 |
| Molecular Formula | C10H16N4 |
| Molecular Weight | 192.27 g/mol |
| Exact Mass | 192.14 |
| IUPAC Name | ethane;2-ethylimidazo[1,2-a]pyrazin-8-amine |
| SMILES | CC.CCc1cn2ccnc(N)c2n1 |
| InChI | InChI=1S/C8H10N4.C2H6/c1-2-6-5-12-4-3-10-7(9)8(12)11-6;1-2/h3-5H,2H2,1H3,(H2,9,10);1-2H3 |
| InChIKey | KVQGZPQHEDRCCN-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.27 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |