C7H6BrN3O — CID 84691652
(8-bromoimidazo[1,2-a]pyrazin-2-yl)methanol (PubChem CID 84691652) has the molecular formula C7H6BrN3O and a molecular weight of 228.05 g/mol. Its IUPAC name is (8-bromoimidazo[1,2-a]pyrazin-2-yl)methanol.
| Compound Name | (8-bromoimidazo[1,2-a]pyrazin-2-yl)methanol |
|---|---|
| PubChem CID | 84691652 |
| Molecular Formula | C7H6BrN3O |
| Molecular Weight | 228.05 g/mol |
| Exact Mass | 226.97 |
| IUPAC Name | (8-bromoimidazo[1,2-a]pyrazin-2-yl)methanol |
| SMILES | OCc1cn2ccnc(Br)c2n1 |
| InChI | InChI=1S/C7H6BrN3O/c8-6-7-10-5(4-12)3-11(7)2-1-9-6/h1-3,12H,4H2 |
| InChIKey | AHFLJIBTLAXTLG-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 50.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.05 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |