C14H18ClN3O — CID 112555032
2-chloro-6-[[(3-ethyl-1-methylpyrazol-4-yl)methylamino]methyl]phenol (PubChem CID 112555032) has the molecular formula C14H18ClN3O and a molecular weight of 279.77 g/mol. Its IUPAC name is 2-chloro-6-[[(3-ethyl-1-methylpyrazol-4-yl)methylamino]methyl]phenol.
| Compound Name | 2-chloro-6-[[(3-ethyl-1-methylpyrazol-4-yl)methylamino]methyl]phenol |
|---|---|
| PubChem CID | 112555032 |
| Molecular Formula | C14H18ClN3O |
| Molecular Weight | 279.77 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | 2-chloro-6-[[(3-ethyl-1-methylpyrazol-4-yl)methylamino]methyl]phenol |
| SMILES | CCc1nn(C)cc1CNCc1cccc(Cl)c1O |
| InChI | InChI=1S/C14H18ClN3O/c1-3-13-11(9-18(2)17-13)8-16-7-10-5-4-6-12(15)14(10)19/h4-6,9,16,19H,3,7-8H2,1-2H3 |
| InChIKey | BGOURHAFJRQTBZ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.77 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|