C15H19ClN4O — CID 115989688
N-(2-chlorophenyl)-2-[(3-ethyl-1-methylpyrazol-4-yl)methylamino]acetamide (PubChem CID 115989688) has the molecular formula C15H19ClN4O and a molecular weight of 306.80 g/mol. Its IUPAC name is N-(2-chlorophenyl)-2-[(3-ethyl-1-methylpyrazol-4-yl)methylamino]acetamide.
| Compound Name | N-(2-chlorophenyl)-2-[(3-ethyl-1-methylpyrazol-4-yl)methylamino]acetamide |
|---|---|
| PubChem CID | 115989688 |
| Molecular Formula | C15H19ClN4O |
| Molecular Weight | 306.80 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | N-(2-chlorophenyl)-2-[(3-ethyl-1-methylpyrazol-4-yl)methylamino]acetamide |
| SMILES | CCc1nn(C)cc1CNCC(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C15H19ClN4O/c1-3-13-11(10-20(2)19-13)8-17-9-15(21)18-14-7-5-4-6-12(14)16/h4-7,10,17H,3,8-9H2,1-2H3,(H,18,21) |
| InChIKey | QIQDYAXWIOKOMH-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.80 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |