C10H11NO5S — CID 112558591
1-[4-(hydroxysulfamoyl)phenyl]cyclopropane-1-carboxylic acid (PubChem CID 112558591) has the molecular formula C10H11NO5S and a molecular weight of 257.27 g/mol. Its IUPAC name is 1-[4-(hydroxysulfamoyl)phenyl]cyclopropane-1-carboxylic acid.
| Compound Name | 1-[4-(hydroxysulfamoyl)phenyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 112558591 |
| Molecular Formula | C10H11NO5S |
| Molecular Weight | 257.27 g/mol |
| Exact Mass | 257.04 |
| IUPAC Name | 1-[4-(hydroxysulfamoyl)phenyl]cyclopropane-1-carboxylic acid |
| SMILES | O=C(O)C1(c2ccc(S(=O)(=O)NO)cc2)CC1 |
| InChI | InChI=1S/C10H11NO5S/c12-9(13)10(5-6-10)7-1-3-8(4-2-7)17(15,16)11-14/h1-4,11,14H,5-6H2,(H,12,13) |
| InChIKey | GPZASCTUPZKFQR-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.27 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|