C9H12BrClN2O2 — CID 112560430
5-bromo-1-(3-chloro-2-hydroxypropyl)-4,6-dimethylpyrimidin-2-one (PubChem CID 112560430) has the molecular formula C9H12BrClN2O2 and a molecular weight of 295.56 g/mol. Its IUPAC name is 5-bromo-1-(3-chloro-2-hydroxypropyl)-4,6-dimethylpyrimidin-2-one.
| Compound Name | 5-bromo-1-(3-chloro-2-hydroxypropyl)-4,6-dimethylpyrimidin-2-one |
|---|---|
| PubChem CID | 112560430 |
| Molecular Formula | C9H12BrClN2O2 |
| Molecular Weight | 295.56 g/mol |
| Exact Mass | 293.98 |
| IUPAC Name | 5-bromo-1-(3-chloro-2-hydroxypropyl)-4,6-dimethylpyrimidin-2-one |
| SMILES | Cc1nc(=O)n(CC(O)CCl)c(C)c1Br |
| InChI | InChI=1S/C9H12BrClN2O2/c1-5-8(10)6(2)13(9(15)12-5)4-7(14)3-11/h7,14H,3-4H2,1-2H3 |
| InChIKey | URXNFTWOBGWGPF-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.56 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|