C12H22ClNO2 — CID 112561817
2-(3-chloro-2-hydroxypropyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol (PubChem CID 112561817) has the molecular formula C12H22ClNO2 and a molecular weight of 247.77 g/mol. Its IUPAC name is 2-(3-chloro-2-hydroxypropyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol.
| Compound Name | 2-(3-chloro-2-hydroxypropyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol |
|---|---|
| PubChem CID | 112561817 |
| Molecular Formula | C12H22ClNO2 |
| Molecular Weight | 247.77 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | 2-(3-chloro-2-hydroxypropyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol |
| SMILES | OC(CCl)CN1CCC2(O)CCCCC2C1 |
| InChI | InChI=1S/C12H22ClNO2/c13-7-11(15)9-14-6-5-12(16)4-2-1-3-10(12)8-14/h10-11,15-16H,1-9H2 |
| InChIKey | IHDJFZLACODRGJ-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.77 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|