C11H18F3NO — CID 114286627
2-(2,2,2-trifluoroethyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol (PubChem CID 114286627) has the molecular formula C11H18F3NO and a molecular weight of 237.26 g/mol. Its IUPAC name is 2-(2,2,2-trifluoroethyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol.
| Compound Name | 2-(2,2,2-trifluoroethyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol |
|---|---|
| PubChem CID | 114286627 |
| Molecular Formula | C11H18F3NO |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | 2-(2,2,2-trifluoroethyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol |
| SMILES | OC12CCCCC1CN(CC(F)(F)F)CC2 |
| InChI | InChI=1S/C11H18F3NO/c12-11(13,14)8-15-6-5-10(16)4-2-1-3-9(10)7-15/h9,16H,1-8H2 |
| InChIKey | SPKYAZPXRZFBEC-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |