C14H24F3NO2 — CID 81115325
2-[3-(2,2,2-trifluoroethoxy)propyl]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol (PubChem CID 81115325) has the molecular formula C14H24F3NO2 and a molecular weight of 295.34 g/mol. Its IUPAC name is 2-[3-(2,2,2-trifluoroethoxy)propyl]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol.
| Compound Name | 2-[3-(2,2,2-trifluoroethoxy)propyl]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol |
|---|---|
| PubChem CID | 81115325 |
| Molecular Formula | C14H24F3NO2 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | 2-[3-(2,2,2-trifluoroethoxy)propyl]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol |
| SMILES | OC12CCCCC1CN(CCCOCC(F)(F)F)CC2 |
| InChI | InChI=1S/C14H24F3NO2/c15-14(16,17)11-20-9-3-7-18-8-6-13(19)5-2-1-4-12(13)10-18/h12,19H,1-11H2 |
| InChIKey | CPJQEOZZNHDCDD-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|