C19H20FN3O2 — CID 11256326
1-[(3-fluorophenyl)methyl]-5-piperazin-1-yl-4H-3,1-benzoxazin-2-one (PubChem CID 11256326) has the molecular formula C19H20FN3O2 and a molecular weight of 341.39 g/mol. Its IUPAC name is 1-[(3-fluorophenyl)methyl]-5-piperazin-1-yl-4H-3,1-benzoxazin-2-one.
| Compound Name | 1-[(3-fluorophenyl)methyl]-5-piperazin-1-yl-4H-3,1-benzoxazin-2-one |
|---|---|
| PubChem CID | 11256326 |
| Molecular Formula | C19H20FN3O2 |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | 1-[(3-fluorophenyl)methyl]-5-piperazin-1-yl-4H-3,1-benzoxazin-2-one |
| SMILES | O=C1OCc2c(N3CCNCC3)cccc2N1Cc1cccc(F)c1 |
| InChI | InChI=1S/C19H20FN3O2/c20-15-4-1-3-14(11-15)12-23-18-6-2-5-17(16(18)13-25-19(23)24)22-9-7-21-8-10-22/h1-6,11,21H,7-10,12-13H2 |
| InChIKey | CZRPTAXTPDFGFM-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |