About 4-[(3-chlorophenyl)methyl]-6-fluoro-8-piperazin-1-yl-1,4-benzoxazin-3-one;hydrochloride
4-[(3-chlorophenyl)methyl]-6-fluoro-8-piperazin-1-yl-1,4-benzoxazin-3-one;hydrochloride (PubChem CID 141090256) has the molecular formula C19H20Cl2FN3O2
and a molecular weight of 412.29 g/mol. Its IUPAC name is 4-[(3-chlorophenyl)methyl]-6-fluoro-8-piperazin-1-yl-1,4-benzoxazin-3-one;hydrochloride.
Molecular Properties
| Compound Name | 4-[(3-chlorophenyl)methyl]-6-fluoro-8-piperazin-1-yl-1,4-benzoxazin-3-one;hydrochloride |
| PubChem CID | 141090256 |
| Molecular Formula | C19H20Cl2FN3O2 |
| Molecular Weight | 412.29 g/mol |
| Exact Mass | 411.09 |
| IUPAC Name | 4-[(3-chlorophenyl)methyl]-6-fluoro-8-piperazin-1-yl-1,4-benzoxazin-3-one;hydrochloride |
| SMILES | Cl.O=C1COc2c(N3CCNCC3)cc(F)cc2N1Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C19H19ClFN3O2.ClH/c20-14-3-1-2-13(8-14)11-24-17-10-15(21)9-16(19(17)26-12-18(24)25)23-6-4-22-5-7-23;/h1-3,8-10,22H,4-7,11-12H2;1H |
| InChIKey | ADPKVZFKEFSZPB-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.29 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[(3-chlorophenyl)methyl]-6-fluoro-8-piperazin-1-yl-1,4-benzoxazin-3-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3-chlorophenyl)methyl]-6-fluoro-8-piperazin-1-yl-1,4-benzoxazin-3-one;hydrochloride?
The IUPAC name of 4-[(3-chlorophenyl)methyl]-6-fluoro-8-piperazin-1-yl-1,4-benzoxazin-3-one;hydrochloride (CID 141090256) is 4-[(3-chlorophenyl)methyl]-6-fluoro-8-piperazin-1-yl-1,4-benzoxazin-3-one;hydrochloride.
What is the SMILES notation for 4-[(3-chlorophenyl)methyl]-6-fluoro-8-piperazin-1-yl-1,4-benzoxazin-3-one;hydrochloride?
The canonical SMILES for 4-[(3-chlorophenyl)methyl]-6-fluoro-8-piperazin-1-yl-1,4-benzoxazin-3-one;hydrochloride is Cl.O=C1COc2c(N3CCNCC3)cc(F)cc2N1Cc1cccc(Cl)c1.
What is the InChIKey of 4-[(3-chlorophenyl)methyl]-6-fluoro-8-piperazin-1-yl-1,4-benzoxazin-3-one;hydrochloride?
The InChIKey is ADPKVZFKEFSZPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19ClFN3O2.ClH/c20-14-3-1-2-13(8-14)11-24-17-10-15(21)9-16(19(17)26-12-18(24)25)23-6-4-22-5-7-23;/h1-3,8-10,22H,4-7,11-12H2;1H.
What are the key properties of 4-[(3-chlorophenyl)methyl]-6-fluoro-8-piperazin-1-yl-1,4-benzoxazin-3-one;hydrochloride?
4-[(3-chlorophenyl)methyl]-6-fluoro-8-piperazin-1-yl-1,4-benzoxazin-3-one;hydrochloride has a molecular weight of 412.29 g/mol, XLogP of 3.24, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3-chlorophenyl)methyl]-6-fluoro-8-piperazin-1-yl-1,4-benzoxazin-3-one;hydrochloride is sourced from PubChem (CID 141090256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).