C14H11ClN2O2 — CID 11837222
4-[(3-chlorophenyl)methyl]pyrido[3,2-b][1,4]oxazin-3-one (PubChem CID 11837222) has the molecular formula C14H11ClN2O2 and a molecular weight of 274.71 g/mol. Its IUPAC name is 4-[(3-chlorophenyl)methyl]pyrido[3,2-b][1,4]oxazin-3-one.
| Compound Name | 4-[(3-chlorophenyl)methyl]pyrido[3,2-b][1,4]oxazin-3-one |
|---|---|
| PubChem CID | 11837222 |
| Molecular Formula | C14H11ClN2O2 |
| Molecular Weight | 274.71 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | 4-[(3-chlorophenyl)methyl]pyrido[3,2-b][1,4]oxazin-3-one |
| SMILES | O=C1COc2cccnc2N1Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C14H11ClN2O2/c15-11-4-1-3-10(7-11)8-17-13(18)9-19-12-5-2-6-16-14(12)17/h1-7H,8-9H2 |
| InChIKey | ZJARCHOMDCOYPY-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.71 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |