C25H20ClN4O2+ — CID 142893450
(3-chlorophenyl)-[4-[3-oxo-4-(pyridin-3-ylmethyl)-1,4-benzoxazin-6-yl]-2-pyridinyl]azanium (PubChem CID 142893450) has the molecular formula C25H20ClN4O2+ and a molecular weight of 443.91 g/mol. Its IUPAC name is (3-chlorophenyl)-[4-[3-oxo-4-(pyridin-3-ylmethyl)-1,4-benzoxazin-6-yl]-2-pyridinyl]azanium.
| Compound Name | (3-chlorophenyl)-[4-[3-oxo-4-(pyridin-3-ylmethyl)-1,4-benzoxazin-6-yl]-2-pyridinyl]azanium |
|---|---|
| PubChem CID | 142893450 |
| Molecular Formula | C25H20ClN4O2+ |
| Molecular Weight | 443.91 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | (3-chlorophenyl)-[4-[3-oxo-4-(pyridin-3-ylmethyl)-1,4-benzoxazin-6-yl]-2-pyridinyl]azanium |
| SMILES | O=C1COc2ccc(-c3ccnc([NH2+]c4cccc(Cl)c4)c3)cc2N1Cc1cccnc1 |
| InChI | InChI=1S/C25H19ClN4O2/c26-20-4-1-5-21(13-20)29-24-12-19(8-10-28-24)18-6-7-23-22(11-18)30(25(31)16-32-23)15-17-3-2-9-27-14-17/h1-14H,15-16H2,(H,28,29)/p+1 |
| InChIKey | PAULCJLWDMURPH-UHFFFAOYSA-O |
| XLogP | 4.25 |
| TPSA | 71.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.91 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|