C25H21N5O3S — CID 142893523
6-[2-(3-methoxysulfanylanilino)pyrimidin-4-yl]-4-(pyridin-4-ylmethyl)-1,4-benzoxazin-3-one (PubChem CID 142893523) has the molecular formula C25H21N5O3S and a molecular weight of 471.54 g/mol. Its IUPAC name is 6-[2-(3-methoxysulfanylanilino)pyrimidin-4-yl]-4-(pyridin-4-ylmethyl)-1,4-benzoxazin-3-one.
| Compound Name | 6-[2-(3-methoxysulfanylanilino)pyrimidin-4-yl]-4-(pyridin-4-ylmethyl)-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 142893523 |
| Molecular Formula | C25H21N5O3S |
| Molecular Weight | 471.54 g/mol |
| Exact Mass | 471.14 |
| IUPAC Name | 6-[2-(3-methoxysulfanylanilino)pyrimidin-4-yl]-4-(pyridin-4-ylmethyl)-1,4-benzoxazin-3-one |
| SMILES | COSc1cccc(Nc2nccc(-c3ccc4c(c3)N(Cc3ccncc3)C(=O)CO4)n2)c1 |
| InChI | InChI=1S/C25H21N5O3S/c1-32-34-20-4-2-3-19(14-20)28-25-27-12-9-21(29-25)18-5-6-23-22(13-18)30(24(31)16-33-23)15-17-7-10-26-11-8-17/h2-14H,15-16H2,1H3,(H,27,28,29) |
| InChIKey | DXDURRHRLLWLCY-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 89.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.54 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|