C15H14N2O4S — CID 72874580
4-[2-(benzenesulfonyl)ethyl]pyrido[3,2-b][1,4]oxazin-3-one (PubChem CID 72874580) has the molecular formula C15H14N2O4S and a molecular weight of 318.35 g/mol. Its IUPAC name is 4-[2-(benzenesulfonyl)ethyl]pyrido[3,2-b][1,4]oxazin-3-one.
| Compound Name | 4-[2-(benzenesulfonyl)ethyl]pyrido[3,2-b][1,4]oxazin-3-one |
|---|---|
| PubChem CID | 72874580 |
| Molecular Formula | C15H14N2O4S |
| Molecular Weight | 318.35 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | 4-[2-(benzenesulfonyl)ethyl]pyrido[3,2-b][1,4]oxazin-3-one |
| SMILES | O=C1COc2cccnc2N1CCS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C15H14N2O4S/c18-14-11-21-13-7-4-8-16-15(13)17(14)9-10-22(19,20)12-5-2-1-3-6-12/h1-8H,9-11H2 |
| InChIKey | BOUDEXIMGNFMHZ-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.35 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |