C21H23N3O3 — CID 97273464
4-[2-oxo-2-[(4R)-4-phenylazepan-1-yl]ethyl]pyrido[3,2-b][1,4]oxazin-3-one (PubChem CID 97273464) has the molecular formula C21H23N3O3 and a molecular weight of 365.43 g/mol. Its IUPAC name is 4-[2-oxo-2-[(4R)-4-phenylazepan-1-yl]ethyl]pyrido[3,2-b][1,4]oxazin-3-one.
| Compound Name | 4-[2-oxo-2-[(4R)-4-phenylazepan-1-yl]ethyl]pyrido[3,2-b][1,4]oxazin-3-one |
|---|---|
| PubChem CID | 97273464 |
| Molecular Formula | C21H23N3O3 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | 4-[2-oxo-2-[(4R)-4-phenylazepan-1-yl]ethyl]pyrido[3,2-b][1,4]oxazin-3-one |
| SMILES | O=C(CN1C(=O)COc2cccnc21)N1CCC[C@@H](c2ccccc2)CC1 |
| InChI | InChI=1S/C21H23N3O3/c25-19(14-24-20(26)15-27-18-9-4-11-22-21(18)24)23-12-5-8-17(10-13-23)16-6-2-1-3-7-16/h1-4,6-7,9,11,17H,5,8,10,12-15H2/t17-/m1/s1 |
| InChIKey | WFLDMCDTBRBFSO-QGZVFWFLSA-N |
| XLogP | 2.60 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |