C23H24N2O2 — CID 97269389
2-[2-oxo-2-[(4S)-4-phenylazepan-1-yl]ethyl]isoquinolin-1-one (PubChem CID 97269389) has the molecular formula C23H24N2O2 and a molecular weight of 360.46 g/mol. Its IUPAC name is 2-[2-oxo-2-[(4S)-4-phenylazepan-1-yl]ethyl]isoquinolin-1-one.
| Compound Name | 2-[2-oxo-2-[(4S)-4-phenylazepan-1-yl]ethyl]isoquinolin-1-one |
|---|---|
| PubChem CID | 97269389 |
| Molecular Formula | C23H24N2O2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | 2-[2-oxo-2-[(4S)-4-phenylazepan-1-yl]ethyl]isoquinolin-1-one |
| SMILES | O=C(Cn1ccc2ccccc2c1=O)N1CCC[C@H](c2ccccc2)CC1 |
| InChI | InChI=1S/C23H24N2O2/c26-22(17-25-16-13-20-9-4-5-11-21(20)23(25)27)24-14-6-10-19(12-15-24)18-7-2-1-3-8-18/h1-5,7-9,11,13,16,19H,6,10,12,14-15,17H2/t19-/m0/s1 |
| InChIKey | IWTPOTLOPFPGTG-IBGZPJMESA-N |
| XLogP | 3.80 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |