C20H23N3O2 — CID 10382444
(2R)-4-benzyl-2-methyl-8-piperazin-1-yl-1,4-benzoxazin-3-one (PubChem CID 10382444) has the molecular formula C20H23N3O2 and a molecular weight of 337.42 g/mol. Its IUPAC name is (2R)-4-benzyl-2-methyl-8-piperazin-1-yl-1,4-benzoxazin-3-one.
| Compound Name | (2R)-4-benzyl-2-methyl-8-piperazin-1-yl-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 10382444 |
| Molecular Formula | C20H23N3O2 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | (2R)-4-benzyl-2-methyl-8-piperazin-1-yl-1,4-benzoxazin-3-one |
| SMILES | C[C@H]1Oc2c(N3CCNCC3)cccc2N(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C20H23N3O2/c1-15-20(24)23(14-16-6-3-2-4-7-16)18-9-5-8-17(19(18)25-15)22-12-10-21-11-13-22/h2-9,15,21H,10-14H2,1H3/t15-/m1/s1 |
| InChIKey | MWURUDGUUWIJED-OAHLLOKOSA-N |
| XLogP | 2.41 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |