C17H18BrN2O2+ — CID 170748694
(4-benzyl-6-bromo-2-methyl-3-oxo-1,4-benzoxazin-7-yl)-methylazanium (PubChem CID 170748694) has the molecular formula C17H18BrN2O2+ and a molecular weight of 362.25 g/mol. Its IUPAC name is (4-benzyl-6-bromo-2-methyl-3-oxo-1,4-benzoxazin-7-yl)-methylazanium.
| Compound Name | (4-benzyl-6-bromo-2-methyl-3-oxo-1,4-benzoxazin-7-yl)-methylazanium |
|---|---|
| PubChem CID | 170748694 |
| Molecular Formula | C17H18BrN2O2+ |
| Molecular Weight | 362.25 g/mol |
| Exact Mass | 361.05 |
| IUPAC Name | (4-benzyl-6-bromo-2-methyl-3-oxo-1,4-benzoxazin-7-yl)-methylazanium |
| SMILES | C[NH2+]c1cc2c(cc1Br)N(Cc1ccccc1)C(=O)C(C)O2 |
| InChI | InChI=1S/C17H17BrN2O2/c1-11-17(21)20(10-12-6-4-3-5-7-12)15-8-13(18)14(19-2)9-16(15)22-11/h3-9,11,19H,10H2,1-2H3/p+1 |
| InChIKey | SZEZEDCOSAZIJW-UHFFFAOYSA-O |
| XLogP | 2.59 |
| TPSA | 46.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.25 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|