C15H19N3O4 — CID 82346291
2-(2-methyl-3-oxo-5-piperazin-1-yl-1,4-benzoxazin-4-yl)acetic acid (PubChem CID 82346291) has the molecular formula C15H19N3O4 and a molecular weight of 305.33 g/mol. Its IUPAC name is 2-(2-methyl-3-oxo-5-piperazin-1-yl-1,4-benzoxazin-4-yl)acetic acid.
| Compound Name | 2-(2-methyl-3-oxo-5-piperazin-1-yl-1,4-benzoxazin-4-yl)acetic acid |
|---|---|
| PubChem CID | 82346291 |
| Molecular Formula | C15H19N3O4 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 2-(2-methyl-3-oxo-5-piperazin-1-yl-1,4-benzoxazin-4-yl)acetic acid |
| SMILES | CC1Oc2cccc(N3CCNCC3)c2N(CC(=O)O)C1=O |
| InChI | InChI=1S/C15H19N3O4/c1-10-15(21)18(9-13(19)20)14-11(3-2-4-12(14)22-10)17-7-5-16-6-8-17/h2-4,10,16H,5-9H2,1H3,(H,19,20) |
| InChIKey | AYYFVQIZPCFPQQ-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |