C20H24N4O3 — CID 89298899
4-[(3-aminophenyl)methyl]-6-methoxy-8-piperazin-1-yl-1,4-benzoxazin-3-one (PubChem CID 89298899) has the molecular formula C20H24N4O3 and a molecular weight of 368.44 g/mol. Its IUPAC name is 4-[(3-aminophenyl)methyl]-6-methoxy-8-piperazin-1-yl-1,4-benzoxazin-3-one.
| Compound Name | 4-[(3-aminophenyl)methyl]-6-methoxy-8-piperazin-1-yl-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 89298899 |
| Molecular Formula | C20H24N4O3 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | 4-[(3-aminophenyl)methyl]-6-methoxy-8-piperazin-1-yl-1,4-benzoxazin-3-one |
| SMILES | COc1cc(N2CCNCC2)c2c(c1)N(Cc1cccc(N)c1)C(=O)CO2 |
| InChI | InChI=1S/C20H24N4O3/c1-26-16-10-17(23-7-5-22-6-8-23)20-18(11-16)24(19(25)13-27-20)12-14-3-2-4-15(21)9-14/h2-4,9-11,22H,5-8,12-13,21H2,1H3 |
| InChIKey | SVXSCNXDPYMYMQ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 80.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|