C13H16BrF2N — CID 112563662
4-[2-(3-bromo-4-fluorophenyl)-1-fluoroethyl]piperidine (PubChem CID 112563662) has the molecular formula C13H16BrF2N and a molecular weight of 304.18 g/mol. Its IUPAC name is 4-[2-(3-bromo-4-fluorophenyl)-1-fluoroethyl]piperidine.
| Compound Name | 4-[2-(3-bromo-4-fluorophenyl)-1-fluoroethyl]piperidine |
|---|---|
| PubChem CID | 112563662 |
| Molecular Formula | C13H16BrF2N |
| Molecular Weight | 304.18 g/mol |
| Exact Mass | 303.04 |
| IUPAC Name | 4-[2-(3-bromo-4-fluorophenyl)-1-fluoroethyl]piperidine |
| SMILES | Fc1ccc(CC(F)C2CCNCC2)cc1Br |
| InChI | InChI=1S/C13H16BrF2N/c14-11-7-9(1-2-12(11)15)8-13(16)10-3-5-17-6-4-10/h1-2,7,10,13,17H,3-6,8H2 |
| InChIKey | DWTUKOGWJVKXOV-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.18 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |