C14H26FN — CID 112563900
4-[(3,5-dimethylcyclohexyl)-fluoromethyl]piperidine (PubChem CID 112563900) has the molecular formula C14H26FN and a molecular weight of 227.37 g/mol. Its IUPAC name is 4-[(3,5-dimethylcyclohexyl)-fluoromethyl]piperidine.
| Compound Name | 4-[(3,5-dimethylcyclohexyl)-fluoromethyl]piperidine |
|---|---|
| PubChem CID | 112563900 |
| Molecular Formula | C14H26FN |
| Molecular Weight | 227.37 g/mol |
| Exact Mass | 227.20 |
| IUPAC Name | 4-[(3,5-dimethylcyclohexyl)-fluoromethyl]piperidine |
| SMILES | CC1CC(C)CC(C(F)C2CCNCC2)C1 |
| InChI | InChI=1S/C14H26FN/c1-10-7-11(2)9-13(8-10)14(15)12-3-5-16-6-4-12/h10-14,16H,3-9H2,1-2H3 |
| InChIKey | MWVFXYYKNXMADN-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.37 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |