C14H17F2N — CID 112564470
3-fluoro-3-(5-fluoro-2-methylphenyl)-8-azabicyclo[3.2.1]octane (PubChem CID 112564470) has the molecular formula C14H17F2N and a molecular weight of 237.29 g/mol. Its IUPAC name is 3-fluoro-3-(5-fluoro-2-methylphenyl)-8-azabicyclo[3.2.1]octane.
| Compound Name | 3-fluoro-3-(5-fluoro-2-methylphenyl)-8-azabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 112564470 |
| Molecular Formula | C14H17F2N |
| Molecular Weight | 237.29 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | 3-fluoro-3-(5-fluoro-2-methylphenyl)-8-azabicyclo[3.2.1]octane |
| SMILES | Cc1ccc(F)cc1C1(F)CC2CCC(C1)N2 |
| InChI | InChI=1S/C14H17F2N/c1-9-2-3-10(15)6-13(9)14(16)7-11-4-5-12(8-14)17-11/h2-3,6,11-12,17H,4-5,7-8H2,1H3 |
| InChIKey | HNZAUKAGGOFXLZ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.29 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |