C10H13BrFNS — CID 112565383
3-[(3-bromothiophen-2-yl)-fluoromethyl]piperidine (PubChem CID 112565383) has the molecular formula C10H13BrFNS and a molecular weight of 278.19 g/mol. Its IUPAC name is 3-[(3-bromothiophen-2-yl)-fluoromethyl]piperidine.
| Compound Name | 3-[(3-bromothiophen-2-yl)-fluoromethyl]piperidine |
|---|---|
| PubChem CID | 112565383 |
| Molecular Formula | C10H13BrFNS |
| Molecular Weight | 278.19 g/mol |
| Exact Mass | 276.99 |
| IUPAC Name | 3-[(3-bromothiophen-2-yl)-fluoromethyl]piperidine |
| SMILES | FC(c1sccc1Br)C1CCCNC1 |
| InChI | InChI=1S/C10H13BrFNS/c11-8-3-5-14-10(8)9(12)7-2-1-4-13-6-7/h3,5,7,9,13H,1-2,4,6H2 |
| InChIKey | NWZSLCUNXRJVBM-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.19 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |