C14H19BrFNO2 — CID 103524207
3-[(3-bromo-2,4-dimethoxyphenyl)-fluoromethyl]piperidine (PubChem CID 103524207) has the molecular formula C14H19BrFNO2 and a molecular weight of 332.21 g/mol. Its IUPAC name is 3-[(3-bromo-2,4-dimethoxyphenyl)-fluoromethyl]piperidine.
| Compound Name | 3-[(3-bromo-2,4-dimethoxyphenyl)-fluoromethyl]piperidine |
|---|---|
| PubChem CID | 103524207 |
| Molecular Formula | C14H19BrFNO2 |
| Molecular Weight | 332.21 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | 3-[(3-bromo-2,4-dimethoxyphenyl)-fluoromethyl]piperidine |
| SMILES | COc1ccc(C(F)C2CCCNC2)c(OC)c1Br |
| InChI | InChI=1S/C14H19BrFNO2/c1-18-11-6-5-10(14(19-2)12(11)15)13(16)9-4-3-7-17-8-9/h5-6,9,13,17H,3-4,7-8H2,1-2H3 |
| InChIKey | RWZIRYDRQSBCDA-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.21 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |