C14H19F2NO — CID 84804959
3-[[3-(difluoromethyl)-4-methoxyphenyl]methyl]piperidine (PubChem CID 84804959) has the molecular formula C14H19F2NO and a molecular weight of 255.31 g/mol. Its IUPAC name is 3-[[3-(difluoromethyl)-4-methoxyphenyl]methyl]piperidine.
| Compound Name | 3-[[3-(difluoromethyl)-4-methoxyphenyl]methyl]piperidine |
|---|---|
| PubChem CID | 84804959 |
| Molecular Formula | C14H19F2NO |
| Molecular Weight | 255.31 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | 3-[[3-(difluoromethyl)-4-methoxyphenyl]methyl]piperidine |
| SMILES | COc1ccc(CC2CCCNC2)cc1C(F)F |
| InChI | InChI=1S/C14H19F2NO/c1-18-13-5-4-10(8-12(13)14(15)16)7-11-3-2-6-17-9-11/h4-5,8,11,14,17H,2-3,6-7,9H2,1H3 |
| InChIKey | FMVXIQHFLCCRPM-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.31 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |