C20H31NO — CID 117485752
3-[[4-methoxy-3-(4-methylcyclohexyl)phenyl]methyl]piperidine (PubChem CID 117485752) has the molecular formula C20H31NO and a molecular weight of 301.47 g/mol. Its IUPAC name is 3-[[4-methoxy-3-(4-methylcyclohexyl)phenyl]methyl]piperidine.
| Compound Name | 3-[[4-methoxy-3-(4-methylcyclohexyl)phenyl]methyl]piperidine |
|---|---|
| PubChem CID | 117485752 |
| Molecular Formula | C20H31NO |
| Molecular Weight | 301.47 g/mol |
| Exact Mass | 301.24 |
| IUPAC Name | 3-[[4-methoxy-3-(4-methylcyclohexyl)phenyl]methyl]piperidine |
| SMILES | COc1ccc(CC2CCCNC2)cc1C1CCC(C)CC1 |
| InChI | InChI=1S/C20H31NO/c1-15-5-8-18(9-6-15)19-13-16(7-10-20(19)22-2)12-17-4-3-11-21-14-17/h7,10,13,15,17-18,21H,3-6,8-9,11-12,14H2,1-2H3 |
| InChIKey | DVFFZNFYFUZTOU-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.47 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |