C21H19NO2S — CID 11256584
5-methyl-7-(3-methylphenyl)-5-thiophen-2-yl-1H-4,1-benzoxazepin-2-one (PubChem CID 11256584) has the molecular formula C21H19NO2S and a molecular weight of 349.46 g/mol. Its IUPAC name is 5-methyl-7-(3-methylphenyl)-5-thiophen-2-yl-1H-4,1-benzoxazepin-2-one.
| Compound Name | 5-methyl-7-(3-methylphenyl)-5-thiophen-2-yl-1H-4,1-benzoxazepin-2-one |
|---|---|
| PubChem CID | 11256584 |
| Molecular Formula | C21H19NO2S |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | 5-methyl-7-(3-methylphenyl)-5-thiophen-2-yl-1H-4,1-benzoxazepin-2-one |
| SMILES | Cc1cccc(-c2ccc3c(c2)C(C)(c2cccs2)OCC(=O)N3)c1 |
| InChI | InChI=1S/C21H19NO2S/c1-14-5-3-6-15(11-14)16-8-9-18-17(12-16)21(2,19-7-4-10-25-19)24-13-20(23)22-18/h3-12H,13H2,1-2H3,(H,22,23) |
| InChIKey | AYCBHEOCOUDZNR-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |