C11H19ClFN3 — CID 112565954
2-[(4-chloro-3-ethyl-1-methylpyrazol-5-yl)methyl]-2-fluorobutan-1-amine (PubChem CID 112565954) has the molecular formula C11H19ClFN3 and a molecular weight of 247.74 g/mol. Its IUPAC name is 2-[(4-chloro-3-ethyl-1-methylpyrazol-5-yl)methyl]-2-fluorobutan-1-amine.
| Compound Name | 2-[(4-chloro-3-ethyl-1-methylpyrazol-5-yl)methyl]-2-fluorobutan-1-amine |
|---|---|
| PubChem CID | 112565954 |
| Molecular Formula | C11H19ClFN3 |
| Molecular Weight | 247.74 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | 2-[(4-chloro-3-ethyl-1-methylpyrazol-5-yl)methyl]-2-fluorobutan-1-amine |
| SMILES | CCc1nn(C)c(CC(F)(CC)CN)c1Cl |
| InChI | InChI=1S/C11H19ClFN3/c1-4-8-10(12)9(16(3)15-8)6-11(13,5-2)7-14/h4-7,14H2,1-3H3 |
| InChIKey | GJRWZNWRWGFEGP-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.74 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |