C11H18ClN3 — CID 79592250
5-(4-chloro-3-ethyl-1-methylpyrazol-5-yl)pent-3-en-1-amine (PubChem CID 79592250) has the molecular formula C11H18ClN3 and a molecular weight of 227.74 g/mol. Its IUPAC name is 5-(4-chloro-3-ethyl-1-methylpyrazol-5-yl)pent-3-en-1-amine.
| Compound Name | 5-(4-chloro-3-ethyl-1-methylpyrazol-5-yl)pent-3-en-1-amine |
|---|---|
| PubChem CID | 79592250 |
| Molecular Formula | C11H18ClN3 |
| Molecular Weight | 227.74 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | 5-(4-chloro-3-ethyl-1-methylpyrazol-5-yl)pent-3-en-1-amine |
| SMILES | CCc1nn(C)c(CC=CCCN)c1Cl |
| InChI | InChI=1S/C11H18ClN3/c1-3-9-11(12)10(15(2)14-9)7-5-4-6-8-13/h4-5H,3,6-8,13H2,1-2H3 |
| InChIKey | GVRQGBVJQJCSET-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.74 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|