C10H14Cl2N2 — CID 79603940
4-chloro-5-(5-chloropent-2-enyl)-1,3-dimethylpyrazole (PubChem CID 79603940) has the molecular formula C10H14Cl2N2 and a molecular weight of 233.14 g/mol. Its IUPAC name is 4-chloro-5-(5-chloropent-2-enyl)-1,3-dimethylpyrazole.
| Compound Name | 4-chloro-5-(5-chloropent-2-enyl)-1,3-dimethylpyrazole |
|---|---|
| PubChem CID | 79603940 |
| Molecular Formula | C10H14Cl2N2 |
| Molecular Weight | 233.14 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | 4-chloro-5-(5-chloropent-2-enyl)-1,3-dimethylpyrazole |
| SMILES | Cc1nn(C)c(CC=CCCCl)c1Cl |
| InChI | InChI=1S/C10H14Cl2N2/c1-8-10(12)9(14(2)13-8)6-4-3-5-7-11/h3-4H,5-7H2,1-2H3 |
| InChIKey | CYKLEJBPGGIGTM-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.14 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|