C12H22FNO2 — CID 112566001
2-(2,6-dioxaspiro[4.5]decan-9-yl)-2-fluorobutan-1-amine (PubChem CID 112566001) has the molecular formula C12H22FNO2 and a molecular weight of 231.31 g/mol. Its IUPAC name is 2-(2,6-dioxaspiro[4.5]decan-9-yl)-2-fluorobutan-1-amine.
| Compound Name | 2-(2,6-dioxaspiro[4.5]decan-9-yl)-2-fluorobutan-1-amine |
|---|---|
| PubChem CID | 112566001 |
| Molecular Formula | C12H22FNO2 |
| Molecular Weight | 231.31 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | 2-(2,6-dioxaspiro[4.5]decan-9-yl)-2-fluorobutan-1-amine |
| SMILES | CCC(F)(CN)C1CCOC2(CCOC2)C1 |
| InChI | InChI=1S/C12H22FNO2/c1-2-12(13,8-14)10-3-5-16-11(7-10)4-6-15-9-11/h10H,2-9,14H2,1H3 |
| InChIKey | WYXXJOQFCBOJSF-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.31 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |