C12H25FN2 — CID 112566608
2-(azepan-2-yl)-2-fluoro-3,3-dimethylbutan-1-amine (PubChem CID 112566608) has the molecular formula C12H25FN2 and a molecular weight of 216.34 g/mol. Its IUPAC name is 2-(azepan-2-yl)-2-fluoro-3,3-dimethylbutan-1-amine.
| Compound Name | 2-(azepan-2-yl)-2-fluoro-3,3-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 112566608 |
| Molecular Formula | C12H25FN2 |
| Molecular Weight | 216.34 g/mol |
| Exact Mass | 216.20 |
| IUPAC Name | 2-(azepan-2-yl)-2-fluoro-3,3-dimethylbutan-1-amine |
| SMILES | CC(C)(C)C(F)(CN)C1CCCCCN1 |
| InChI | InChI=1S/C12H25FN2/c1-11(2,3)12(13,9-14)10-7-5-4-6-8-15-10/h10,15H,4-9,14H2,1-3H3 |
| InChIKey | BEGBFMXBLMUYOS-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.34 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |