C12H28N4O2 — CID 142662822
1,1,1-triamino-3-(azocan-2-yl)-2-methylbutane-2,3-diol (PubChem CID 142662822) has the molecular formula C12H28N4O2 and a molecular weight of 260.38 g/mol. Its IUPAC name is 1,1,1-triamino-3-(azocan-2-yl)-2-methylbutane-2,3-diol.
| Compound Name | 1,1,1-triamino-3-(azocan-2-yl)-2-methylbutane-2,3-diol |
|---|---|
| PubChem CID | 142662822 |
| Molecular Formula | C12H28N4O2 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.22 |
| IUPAC Name | 1,1,1-triamino-3-(azocan-2-yl)-2-methylbutane-2,3-diol |
| SMILES | CC(O)(C1CCCCCCN1)C(C)(O)C(N)(N)N |
| InChI | InChI=1S/C12H28N4O2/c1-10(17,11(2,18)12(13,14)15)9-7-5-3-4-6-8-16-9/h9,16-18H,3-8,13-15H2,1-2H3 |
| InChIKey | GOUIYFYPTMDPEB-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 130.55 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|