About methyl 2-cyclopentyl-2-[4-(2-methylpropyl)-1,2,4-triazol-3-yl]acetate
methyl 2-cyclopentyl-2-[4-(2-methylpropyl)-1,2,4-triazol-3-yl]acetate (PubChem CID 112569546) has the molecular formula C14H23N3O2
and a molecular weight of 265.36 g/mol. Its IUPAC name is methyl 2-cyclopentyl-2-[4-(2-methylpropyl)-1,2,4-triazol-3-yl]acetate.
Molecular Properties
| Compound Name | methyl 2-cyclopentyl-2-[4-(2-methylpropyl)-1,2,4-triazol-3-yl]acetate |
| PubChem CID | 112569546 |
| Molecular Formula | C14H23N3O2 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | methyl 2-cyclopentyl-2-[4-(2-methylpropyl)-1,2,4-triazol-3-yl]acetate |
| SMILES | COC(=O)C(c1nncn1CC(C)C)C1CCCC1 |
| InChI | InChI=1S/C14H23N3O2/c1-10(2)8-17-9-15-16-13(17)12(14(18)19-3)11-6-4-5-7-11/h9-12H,4-8H2,1-3H3 |
| InChIKey | NMDODPZUPATHJC-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 2-cyclopentyl-2-[4-(2-methylpropyl)-1,2,4-triazol-3-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-cyclopentyl-2-[4-(2-methylpropyl)-1,2,4-triazol-3-yl]acetate?
The IUPAC name of methyl 2-cyclopentyl-2-[4-(2-methylpropyl)-1,2,4-triazol-3-yl]acetate (CID 112569546) is methyl 2-cyclopentyl-2-[4-(2-methylpropyl)-1,2,4-triazol-3-yl]acetate.
What is the SMILES notation for methyl 2-cyclopentyl-2-[4-(2-methylpropyl)-1,2,4-triazol-3-yl]acetate?
The canonical SMILES for methyl 2-cyclopentyl-2-[4-(2-methylpropyl)-1,2,4-triazol-3-yl]acetate is COC(=O)C(c1nncn1CC(C)C)C1CCCC1.
What is the InChIKey of methyl 2-cyclopentyl-2-[4-(2-methylpropyl)-1,2,4-triazol-3-yl]acetate?
The InChIKey is NMDODPZUPATHJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23N3O2/c1-10(2)8-17-9-15-16-13(17)12(14(18)19-3)11-6-4-5-7-11/h9-12H,4-8H2,1-3H3.
What are the key properties of methyl 2-cyclopentyl-2-[4-(2-methylpropyl)-1,2,4-triazol-3-yl]acetate?
methyl 2-cyclopentyl-2-[4-(2-methylpropyl)-1,2,4-triazol-3-yl]acetate has a molecular weight of 265.36 g/mol, XLogP of 2.38, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-cyclopentyl-2-[4-(2-methylpropyl)-1,2,4-triazol-3-yl]acetate is sourced from PubChem (CID 112569546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).