C17H23NS — CID 112569750
3-(1-benzothiophen-3-yl)-2-cyclopentyl-N-methylpropan-1-amine (PubChem CID 112569750) has the molecular formula C17H23NS and a molecular weight of 273.44 g/mol. Its IUPAC name is 3-(1-benzothiophen-3-yl)-2-cyclopentyl-N-methylpropan-1-amine.
| Compound Name | 3-(1-benzothiophen-3-yl)-2-cyclopentyl-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 112569750 |
| Molecular Formula | C17H23NS |
| Molecular Weight | 273.44 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | 3-(1-benzothiophen-3-yl)-2-cyclopentyl-N-methylpropan-1-amine |
| SMILES | CNCC(Cc1csc2ccccc12)C1CCCC1 |
| InChI | InChI=1S/C17H23NS/c1-18-11-14(13-6-2-3-7-13)10-15-12-19-17-9-5-4-8-16(15)17/h4-5,8-9,12-14,18H,2-3,6-7,10-11H2,1H3 |
| InChIKey | KQGUXVVSMKGRLE-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.44 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |