C18H23NOS2 — CID 146079150
N-[1-(1-benzothiophen-3-yl)propan-2-yl]-2-cyclopentylsulfanylacetamide (PubChem CID 146079150) has the molecular formula C18H23NOS2 and a molecular weight of 333.52 g/mol. Its IUPAC name is N-[1-(1-benzothiophen-3-yl)propan-2-yl]-2-cyclopentylsulfanylacetamide.
| Compound Name | N-[1-(1-benzothiophen-3-yl)propan-2-yl]-2-cyclopentylsulfanylacetamide |
|---|---|
| PubChem CID | 146079150 |
| Molecular Formula | C18H23NOS2 |
| Molecular Weight | 333.52 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | N-[1-(1-benzothiophen-3-yl)propan-2-yl]-2-cyclopentylsulfanylacetamide |
| SMILES | CC(Cc1csc2ccccc12)NC(=O)CSC1CCCC1 |
| InChI | InChI=1S/C18H23NOS2/c1-13(19-18(20)12-21-15-6-2-3-7-15)10-14-11-22-17-9-5-4-8-16(14)17/h4-5,8-9,11,13,15H,2-3,6-7,10,12H2,1H3,(H,19,20) |
| InChIKey | FCXFZJPUTPLPFU-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.52 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |