C18H16BrNOS — CID 119106153
N-[1-(1-benzothiophen-3-yl)propan-2-yl]-2-bromobenzamide (PubChem CID 119106153) has the molecular formula C18H16BrNOS and a molecular weight of 374.30 g/mol. Its IUPAC name is N-[1-(1-benzothiophen-3-yl)propan-2-yl]-2-bromobenzamide.
| Compound Name | N-[1-(1-benzothiophen-3-yl)propan-2-yl]-2-bromobenzamide |
|---|---|
| PubChem CID | 119106153 |
| Molecular Formula | C18H16BrNOS |
| Molecular Weight | 374.30 g/mol |
| Exact Mass | 373.01 |
| IUPAC Name | N-[1-(1-benzothiophen-3-yl)propan-2-yl]-2-bromobenzamide |
| SMILES | CC(Cc1csc2ccccc12)NC(=O)c1ccccc1Br |
| InChI | InChI=1S/C18H16BrNOS/c1-12(20-18(21)15-7-2-4-8-16(15)19)10-13-11-22-17-9-5-3-6-14(13)17/h2-9,11-12H,10H2,1H3,(H,20,21) |
| InChIKey | KIAZHGMMVYLINF-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.30 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |