About Monoacetyldapsone
Monoacetyldapsone (PubChem CID 11257) has the molecular formula C14H14N2O3S
and a molecular weight of 290.34 g/mol. Its IUPAC name is N-[4-(4-aminophenyl)sulfonylphenyl]acetamide.
Molecular Properties
| Compound Name | Monoacetyldapsone |
| PubChem CID | 11257 |
| Molecular Formula | C14H14N2O3S |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | N-[4-(4-aminophenyl)sulfonylphenyl]acetamide |
| SMILES | CC(=O)NC1=CC=C(C=C1)S(=O)(=O)C2=CC=C(C=C2)N |
| InChI | InChI=1S/C14H14N2O3S/c1-10(17)16-12-4-8-14(9-5-12)20(18,19)13-6-2-11(15)3-7-13/h2-9H,15H2,1H3,(H,16,17) |
| InChIKey | WDOCBIHNYYQINH-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 97.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | 428 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze Monoacetyldapsone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Monoacetyldapsone?
The IUPAC name of Monoacetyldapsone (CID 11257) is N-[4-(4-aminophenyl)sulfonylphenyl]acetamide.
What is the SMILES notation for Monoacetyldapsone?
The canonical SMILES for Monoacetyldapsone is CC(=O)NC1=CC=C(C=C1)S(=O)(=O)C2=CC=C(C=C2)N.
What is the InChIKey of Monoacetyldapsone?
The InChIKey is WDOCBIHNYYQINH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N2O3S/c1-10(17)16-12-4-8-14(9-5-12)20(18,19)13-6-2-11(15)3-7-13/h2-9H,15H2,1H3,(H,16,17).
What are the key properties of Monoacetyldapsone?
Monoacetyldapsone has a molecular weight of 290.34 g/mol, XLogP of 0.90, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for Monoacetyldapsone is sourced from PubChem (CID 11257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).