About Sulfanitran
Sulfanitran (PubChem CID 5334) has the molecular formula C14H13N3O5S
and a molecular weight of 335.34 g/mol. Its IUPAC name is N-[4-[(4-nitrophenyl)sulfamoyl]phenyl]acetamide.
Molecular Properties
| Compound Name | Sulfanitran |
| PubChem CID | 5334 |
| Molecular Formula | C14H13N3O5S |
| Molecular Weight | 335.34 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | N-[4-[(4-nitrophenyl)sulfamoyl]phenyl]acetamide |
| SMILES | CC(=O)NC1=CC=C(C=C1)S(=O)(=O)NC2=CC=C(C=C2)[N+](=O)[O-] |
| InChI | InChI=1S/C14H13N3O5S/c1-10(18)15-11-4-8-14(9-5-11)23(21,22)16-12-2-6-13(7-3-12)17(19)20/h2-9,16H,1H3,(H,15,18) |
| InChIKey | GWBPFRGXNGPPMF-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 129.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | 524 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.34 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze Sulfanitran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Sulfanitran?
The IUPAC name of Sulfanitran (CID 5334) is N-[4-[(4-nitrophenyl)sulfamoyl]phenyl]acetamide.
What is the SMILES notation for Sulfanitran?
The canonical SMILES for Sulfanitran is CC(=O)NC1=CC=C(C=C1)S(=O)(=O)NC2=CC=C(C=C2)[N+](=O)[O-].
What is the InChIKey of Sulfanitran?
The InChIKey is GWBPFRGXNGPPMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13N3O5S/c1-10(18)15-11-4-8-14(9-5-11)23(21,22)16-12-2-6-13(7-3-12)17(19)20/h2-9,16H,1H3,(H,15,18).
What are the key properties of Sulfanitran?
Sulfanitran has a molecular weight of 335.34 g/mol, XLogP of 2.00, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for Sulfanitran is sourced from PubChem (CID 5334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).