C19H20N4O4 — CID 11257155
4-[[4-(1H-indole-2-carbonylamino)-1-methylpyrrole-2-carbonyl]amino]butanoic acid (PubChem CID 11257155) has the molecular formula C19H20N4O4 and a molecular weight of 368.39 g/mol. Its IUPAC name is 4-[[4-(1H-indole-2-carbonylamino)-1-methylpyrrole-2-carbonyl]amino]butanoic acid.
| Compound Name | 4-[[4-(1H-indole-2-carbonylamino)-1-methylpyrrole-2-carbonyl]amino]butanoic acid |
|---|---|
| PubChem CID | 11257155 |
| Molecular Formula | C19H20N4O4 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | 4-[[4-(1H-indole-2-carbonylamino)-1-methylpyrrole-2-carbonyl]amino]butanoic acid |
| SMILES | Cn1cc(NC(=O)c2cc3ccccc3[nH]2)cc1C(=O)NCCCC(=O)O |
| InChI | InChI=1S/C19H20N4O4/c1-23-11-13(10-16(23)19(27)20-8-4-7-17(24)25)21-18(26)15-9-12-5-2-3-6-14(12)22-15/h2-3,5-6,9-11,22H,4,7-8H2,1H3,(H,20,27)(H,21,26)(H,24,25) |
| InChIKey | AHKSKDYCIOWXAL-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 116.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|