C10H4FIN2OS — CID 112572205
5-(6-fluoro-1-benzothiophen-2-yl)-3-iodo-1,2,4-oxadiazole (PubChem CID 112572205) has the molecular formula C10H4FIN2OS and a molecular weight of 346.12 g/mol. Its IUPAC name is 5-(6-fluoro-1-benzothiophen-2-yl)-3-iodo-1,2,4-oxadiazole.
| Compound Name | 5-(6-fluoro-1-benzothiophen-2-yl)-3-iodo-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 112572205 |
| Molecular Formula | C10H4FIN2OS |
| Molecular Weight | 346.12 g/mol |
| Exact Mass | 345.91 |
| IUPAC Name | 5-(6-fluoro-1-benzothiophen-2-yl)-3-iodo-1,2,4-oxadiazole |
| SMILES | Fc1ccc2cc(-c3nc(I)no3)sc2c1 |
| InChI | InChI=1S/C10H4FIN2OS/c11-6-2-1-5-3-8(16-7(5)4-6)9-13-10(12)14-15-9/h1-4H |
| InChIKey | FQDGNQALSVTJTD-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.12 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|