C14H12ClFN2OS — CID 103095933
3-(1-chlorobutyl)-5-(6-fluoro-1-benzothiophen-2-yl)-1,2,4-oxadiazole (PubChem CID 103095933) has the molecular formula C14H12ClFN2OS and a molecular weight of 310.78 g/mol. Its IUPAC name is 3-(1-chlorobutyl)-5-(6-fluoro-1-benzothiophen-2-yl)-1,2,4-oxadiazole.
| Compound Name | 3-(1-chlorobutyl)-5-(6-fluoro-1-benzothiophen-2-yl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 103095933 |
| Molecular Formula | C14H12ClFN2OS |
| Molecular Weight | 310.78 g/mol |
| Exact Mass | 310.03 |
| IUPAC Name | 3-(1-chlorobutyl)-5-(6-fluoro-1-benzothiophen-2-yl)-1,2,4-oxadiazole |
| SMILES | CCCC(Cl)c1noc(-c2cc3ccc(F)cc3s2)n1 |
| InChI | InChI=1S/C14H12ClFN2OS/c1-2-3-10(15)13-17-14(19-18-13)12-6-8-4-5-9(16)7-11(8)20-12/h4-7,10H,2-3H2,1H3 |
| InChIKey | ZALLAJPXSKYWBK-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.78 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|