C10H13IN2O — CID 112572311
5-(2-bicyclo[2.2.1]heptanylmethyl)-3-iodo-1,2,4-oxadiazole (PubChem CID 112572311) has the molecular formula C10H13IN2O and a molecular weight of 304.13 g/mol. Its IUPAC name is 5-(2-bicyclo[2.2.1]heptanylmethyl)-3-iodo-1,2,4-oxadiazole.
| Compound Name | 5-(2-bicyclo[2.2.1]heptanylmethyl)-3-iodo-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 112572311 |
| Molecular Formula | C10H13IN2O |
| Molecular Weight | 304.13 g/mol |
| Exact Mass | 304.01 |
| IUPAC Name | 5-(2-bicyclo[2.2.1]heptanylmethyl)-3-iodo-1,2,4-oxadiazole |
| SMILES | Ic1noc(CC2CC3CCC2C3)n1 |
| InChI | InChI=1S/C10H13IN2O/c11-10-12-9(14-13-10)5-8-4-6-1-2-7(8)3-6/h6-8H,1-5H2 |
| InChIKey | GUZHLCATKBHCPI-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.13 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|