C11H15IN2O — CID 79557816
5-(2-bicyclo[2.2.1]heptanylmethyl)-4-iodo-1,2-oxazol-3-amine (PubChem CID 79557816) has the molecular formula C11H15IN2O and a molecular weight of 318.16 g/mol. Its IUPAC name is 5-(2-bicyclo[2.2.1]heptanylmethyl)-4-iodo-1,2-oxazol-3-amine.
| Compound Name | 5-(2-bicyclo[2.2.1]heptanylmethyl)-4-iodo-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 79557816 |
| Molecular Formula | C11H15IN2O |
| Molecular Weight | 318.16 g/mol |
| Exact Mass | 318.02 |
| IUPAC Name | 5-(2-bicyclo[2.2.1]heptanylmethyl)-4-iodo-1,2-oxazol-3-amine |
| SMILES | Nc1noc(CC2CC3CCC2C3)c1I |
| InChI | InChI=1S/C11H15IN2O/c12-10-9(15-14-11(10)13)5-8-4-6-1-2-7(8)3-6/h6-8H,1-5H2,(H2,13,14) |
| InChIKey | VWDSRMOHOAPXOH-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.16 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|