C9H9IN2O2 — CID 112572451
3-iodo-5-(2,4,5-trimethylfuran-3-yl)-1,2,4-oxadiazole (PubChem CID 112572451) has the molecular formula C9H9IN2O2 and a molecular weight of 304.09 g/mol. Its IUPAC name is 3-iodo-5-(2,4,5-trimethylfuran-3-yl)-1,2,4-oxadiazole.
| Compound Name | 3-iodo-5-(2,4,5-trimethylfuran-3-yl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 112572451 |
| Molecular Formula | C9H9IN2O2 |
| Molecular Weight | 304.09 g/mol |
| Exact Mass | 303.97 |
| IUPAC Name | 3-iodo-5-(2,4,5-trimethylfuran-3-yl)-1,2,4-oxadiazole |
| SMILES | Cc1oc(C)c(-c2nc(I)no2)c1C |
| InChI | InChI=1S/C9H9IN2O2/c1-4-5(2)13-6(3)7(4)8-11-9(10)12-14-8/h1-3H3 |
| InChIKey | LXQBBGXCDHQIFX-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 52.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.09 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|